C9H26AlN3 — CID 174343884
alumane;2-N,3-N,3-N'-trimethylhexane-2,3,3-triamine (PubChem CID 174343884) has the molecular formula C9H26AlN3 and a molecular weight of 203.31 g/mol. Its IUPAC name is alumane;2-N,3-N,3-N'-trimethylhexane-2,3,3-triamine.
| Compound Name | alumane;2-N,3-N,3-N'-trimethylhexane-2,3,3-triamine |
|---|---|
| PubChem CID | 174343884 |
| Molecular Formula | C9H26AlN3 |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | alumane;2-N,3-N,3-N'-trimethylhexane-2,3,3-triamine |
| SMILES | CCCC(NC)(NC)C(C)NC.[AlH3] |
| InChI | InChI=1S/C9H23N3.Al.3H/c1-6-7-9(11-4,12-5)8(2)10-3;;;;/h8,10-12H,6-7H2,1-5H3;;;; |
| InChIKey | RUEVKCFWUQBWHD-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|