C13H29N3 — CID 174433908
2-N,3-N,6-N,3,7-pentamethyloct-6-ene-2,3,6-triamine (PubChem CID 174433908) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is 2-N,3-N,6-N,3,7-pentamethyloct-6-ene-2,3,6-triamine.
| Compound Name | 2-N,3-N,6-N,3,7-pentamethyloct-6-ene-2,3,6-triamine |
|---|---|
| PubChem CID | 174433908 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | 2-N,3-N,6-N,3,7-pentamethyloct-6-ene-2,3,6-triamine |
| SMILES | CNC(CCC(C)(NC)C(C)NC)=C(C)C |
| InChI | InChI=1S/C13H29N3/c1-10(2)12(15-6)8-9-13(4,16-7)11(3)14-5/h11,14-16H,8-9H2,1-7H3 |
| InChIKey | ZFGVPROBPYQLQT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |