C24H18N4O3S2 — CID 17434452
N-(9,10-dioxoanthracen-1-yl)-2-[[5-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 17434452) has the molecular formula C24H18N4O3S2 and a molecular weight of 474.57 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-[[5-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-[[5-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 17434452 |
| Molecular Formula | C24H18N4O3S2 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-[[5-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | CC(Sc1n[nH]c(Cc2cccs2)n1)C(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H18N4O3S2/c1-13(33-24-26-19(27-28-24)12-14-6-5-11-32-14)23(31)25-18-10-4-9-17-20(18)22(30)16-8-3-2-7-15(16)21(17)29/h2-11,13H,12H2,1H3,(H,25,31)(H,26,27,28) |
| InChIKey | RHVSPMFYHNBTQP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|