C32H43NO5 — CID 174348059
tert-butyl N-[(1S)-2-cyclohexyl-1-[5-formyl-4-[(4-phenylmethoxyphenyl)methyl]oxolan-2-yl]ethyl]carbamate (PubChem CID 174348059) has the molecular formula C32H43NO5 and a molecular weight of 521.70 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-cyclohexyl-1-[5-formyl-4-[(4-phenylmethoxyphenyl)methyl]oxolan-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-cyclohexyl-1-[5-formyl-4-[(4-phenylmethoxyphenyl)methyl]oxolan-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 174348059 |
| Molecular Formula | C32H43NO5 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | tert-butyl N-[(1S)-2-cyclohexyl-1-[5-formyl-4-[(4-phenylmethoxyphenyl)methyl]oxolan-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1CCCCC1)C1CC(Cc2ccc(OCc3ccccc3)cc2)C(C=O)O1 |
| InChI | InChI=1S/C32H43NO5/c1-32(2,3)38-31(35)33-28(19-23-10-6-4-7-11-23)29-20-26(30(21-34)37-29)18-24-14-16-27(17-15-24)36-22-25-12-8-5-9-13-25/h5,8-9,12-17,21,23,26,28-30H,4,6-7,10-11,18-20,22H2,1-3H3,(H,33,35)/t26?,28-,29?,30?/m0/s1 |
| InChIKey | KDIYNFJYCGYBLK-JQWJHRRBSA-N |
| XLogP | 6.64 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|