About propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride
propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride (PubChem CID 174349656) has the molecular formula C11H11Cl2F3O5S
and a molecular weight of 383.17 g/mol. Its IUPAC name is propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride.
Molecular Properties
| Compound Name | propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride |
| PubChem CID | 174349656 |
| Molecular Formula | C11H11Cl2F3O5S |
| Molecular Weight | 383.17 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride |
| SMILES | CC(C)OC(=O)c1cccc(OC(F)(F)F)c1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C11H11F3O3.Cl2O2S/c1-7(2)16-10(15)8-4-3-5-9(6-8)17-11(12,13)14;1-5(2,3)4/h3-7H,1-2H3; |
| InChIKey | HQXSCDXOHLQIRS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.17 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride?
The IUPAC name of propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride (CID 174349656) is propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride.
What is the SMILES notation for propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride?
The canonical SMILES for propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride is CC(C)OC(=O)c1cccc(OC(F)(F)F)c1.O=S(=O)(Cl)Cl.
What is the InChIKey of propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride?
The InChIKey is HQXSCDXOHLQIRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3O3.Cl2O2S/c1-7(2)16-10(15)8-4-3-5-9(6-8)17-11(12,13)14;1-5(2,3)4/h3-7H,1-2H3;.
What are the key properties of propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride?
propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride has a molecular weight of 383.17 g/mol, XLogP of 3.86, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-(trifluoromethoxy)benzoate;sulfuryl dichloride is sourced from PubChem (CID 174349656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).