About 3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate
3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate (PubChem CID 174355131) has the molecular formula C13H27NO4S
and a molecular weight of 293.43 g/mol. Its IUPAC name is 3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate.
Molecular Properties
| Compound Name | 3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate |
| PubChem CID | 174355131 |
| Molecular Formula | C13H27NO4S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate |
| SMILES | CCC(C)(CC)OC(=O)C(C)(CC)CNS(C)(=O)=O |
| InChI | InChI=1S/C13H27NO4S/c1-7-12(4,10-14-19(6,16)17)11(15)18-13(5,8-2)9-3/h14H,7-10H2,1-6H3 |
| InChIKey | VMSPVXKPLDXGMS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate?
The IUPAC name of 3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate (CID 174355131) is 3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate.
What is the SMILES notation for 3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate?
The canonical SMILES for 3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate is CCC(C)(CC)OC(=O)C(C)(CC)CNS(C)(=O)=O.
What is the InChIKey of 3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate?
The InChIKey is VMSPVXKPLDXGMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO4S/c1-7-12(4,10-14-19(6,16)17)11(15)18-13(5,8-2)9-3/h14H,7-10H2,1-6H3.
What are the key properties of 3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate?
3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate has a molecular weight of 293.43 g/mol, XLogP of 2.07, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentan-3-yl 2-(methanesulfonamidomethyl)-2-methylbutanoate is sourced from PubChem (CID 174355131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).