C28H39NO2 — CID 174357914
1-[2-(1,2,3,4,5,6-hexamethylcyclohexyl)-4-methoxyphenyl]-N-(4-methoxyphenyl)ethanimine (PubChem CID 174357914) has the molecular formula C28H39NO2 and a molecular weight of 421.63 g/mol. Its IUPAC name is 1-[2-(1,2,3,4,5,6-hexamethylcyclohexyl)-4-methoxyphenyl]-N-(4-methoxyphenyl)ethanimine.
| Compound Name | 1-[2-(1,2,3,4,5,6-hexamethylcyclohexyl)-4-methoxyphenyl]-N-(4-methoxyphenyl)ethanimine |
|---|---|
| PubChem CID | 174357914 |
| Molecular Formula | C28H39NO2 |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | 1-[2-(1,2,3,4,5,6-hexamethylcyclohexyl)-4-methoxyphenyl]-N-(4-methoxyphenyl)ethanimine |
| SMILES | COc1ccc(/N=C(\C)c2ccc(OC)cc2C2(C)C(C)C(C)C(C)C(C)C2C)cc1 |
| InChI | InChI=1S/C28H39NO2/c1-17-18(2)20(4)28(7,21(5)19(17)3)27-16-25(31-9)14-15-26(27)22(6)29-23-10-12-24(30-8)13-11-23/h10-21H,1-9H3/b29-22+ |
| InChIKey | XRYVEYBOLDCMIT-QUPMIFSKSA-N |
| XLogP | 7.30 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|