About pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate
pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate (PubChem CID 174359749) has the molecular formula C15H24N2O4
and a molecular weight of 296.37 g/mol. Its IUPAC name is pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate.
Molecular Properties
| Compound Name | pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate |
| PubChem CID | 174359749 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate |
| SMILES | CCCCC(=O)OC(=O)c1nc(CCC)[nH]c1C(C)(C)O |
| InChI | InChI=1S/C15H24N2O4/c1-5-7-9-11(18)21-14(19)12-13(15(3,4)20)17-10(16-12)8-6-2/h20H,5-9H2,1-4H3,(H,16,17) |
| InChIKey | HECXAGCIKIMNCB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate?
The IUPAC name of pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate (CID 174359749) is pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate.
What is the SMILES notation for pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate?
The canonical SMILES for pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate is CCCCC(=O)OC(=O)c1nc(CCC)[nH]c1C(C)(C)O.
What is the InChIKey of pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate?
The InChIKey is HECXAGCIKIMNCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O4/c1-5-7-9-11(18)21-14(19)12-13(15(3,4)20)17-10(16-12)8-6-2/h20H,5-9H2,1-4H3,(H,16,17).
What are the key properties of pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate?
pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate has a molecular weight of 296.37 g/mol, XLogP of 2.46, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pentanoyl 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylate is sourced from PubChem (CID 174359749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).