About 2-butyl-1H-imidazole-4,5-dicarboxylic acid
2-butyl-1H-imidazole-4,5-dicarboxylic acid (PubChem CID 19036100) has the molecular formula C9H12N2O4
and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-butyl-1H-imidazole-4,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-butyl-1H-imidazole-4,5-dicarboxylic acid |
| PubChem CID | 19036100 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-butyl-1H-imidazole-4,5-dicarboxylic acid |
| SMILES | CCCCc1nc(C(=O)O)c(C(=O)O)[nH]1 |
| InChI | InChI=1S/C9H12N2O4/c1-2-3-4-5-10-6(8(12)13)7(11-5)9(14)15/h2-4H2,1H3,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | UFVLIGITZXQUON-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butyl-1H-imidazole-4,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1H-imidazole-4,5-dicarboxylic acid?
The IUPAC name of 2-butyl-1H-imidazole-4,5-dicarboxylic acid (CID 19036100) is 2-butyl-1H-imidazole-4,5-dicarboxylic acid.
What is the SMILES notation for 2-butyl-1H-imidazole-4,5-dicarboxylic acid?
The canonical SMILES for 2-butyl-1H-imidazole-4,5-dicarboxylic acid is CCCCc1nc(C(=O)O)c(C(=O)O)[nH]1.
What is the InChIKey of 2-butyl-1H-imidazole-4,5-dicarboxylic acid?
The InChIKey is UFVLIGITZXQUON-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c1-2-3-4-5-10-6(8(12)13)7(11-5)9(14)15/h2-4H2,1H3,(H,10,11)(H,12,13)(H,14,15).
What are the key properties of 2-butyl-1H-imidazole-4,5-dicarboxylic acid?
2-butyl-1H-imidazole-4,5-dicarboxylic acid has a molecular weight of 212.20 g/mol, XLogP of 1.15, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1H-imidazole-4,5-dicarboxylic acid is sourced from PubChem (CID 19036100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).