C15H17N3O5S — CID 174360520
ethyl 2-[1-[4-(methanesulfonamido)phenyl]-4-methylidene-5-oxopyrazol-3-yl]acetate (PubChem CID 174360520) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is ethyl 2-[1-[4-(methanesulfonamido)phenyl]-4-methylidene-5-oxopyrazol-3-yl]acetate.
| Compound Name | ethyl 2-[1-[4-(methanesulfonamido)phenyl]-4-methylidene-5-oxopyrazol-3-yl]acetate |
|---|---|
| PubChem CID | 174360520 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | ethyl 2-[1-[4-(methanesulfonamido)phenyl]-4-methylidene-5-oxopyrazol-3-yl]acetate |
| SMILES | C=C1C(=O)N(c2ccc(NS(C)(=O)=O)cc2)N=C1CC(=O)OCC |
| InChI | InChI=1S/C15H17N3O5S/c1-4-23-14(19)9-13-10(2)15(20)18(16-13)12-7-5-11(6-8-12)17-24(3,21)22/h5-8,17H,2,4,9H2,1,3H3 |
| InChIKey | QTZYVHMBBOMVEC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|