C23H28N4O5S — CID 174360519
2-ethylaniline;ethyl 2-[1-[4-(methanesulfonamido)phenyl]-4-methylidene-5-oxopyrazol-3-yl]acetate (PubChem CID 174360519) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is 2-ethylaniline;ethyl 2-[1-[4-(methanesulfonamido)phenyl]-4-methylidene-5-oxopyrazol-3-yl]acetate.
| Compound Name | 2-ethylaniline;ethyl 2-[1-[4-(methanesulfonamido)phenyl]-4-methylidene-5-oxopyrazol-3-yl]acetate |
|---|---|
| PubChem CID | 174360519 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-ethylaniline;ethyl 2-[1-[4-(methanesulfonamido)phenyl]-4-methylidene-5-oxopyrazol-3-yl]acetate |
| SMILES | C=C1C(=O)N(c2ccc(NS(C)(=O)=O)cc2)N=C1CC(=O)OCC.CCc1ccccc1N |
| InChI | InChI=1S/C15H17N3O5S.C8H11N/c1-4-23-14(19)9-13-10(2)15(20)18(16-13)12-7-5-11(6-8-12)17-24(3,21)22;1-2-7-5-3-4-6-8(7)9/h5-8,17H,2,4,9H2,1,3H3;3-6H,2,9H2,1H3 |
| InChIKey | ALOQOWCYVYMOQB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|