C17H17N3O3S2 — CID 17436210
N-benzo[e][1,3]benzothiazol-2-yl-1-methylsulfonylpyrrolidine-2-carboxamide (PubChem CID 17436210) has the molecular formula C17H17N3O3S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is N-benzo[e][1,3]benzothiazol-2-yl-1-methylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-benzo[e][1,3]benzothiazol-2-yl-1-methylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 17436210 |
| Molecular Formula | C17H17N3O3S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | N-benzo[e][1,3]benzothiazol-2-yl-1-methylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC1C(=O)Nc1nc2c(ccc3ccccc32)s1 |
| InChI | InChI=1S/C17H17N3O3S2/c1-25(22,23)20-10-4-7-13(20)16(21)19-17-18-15-12-6-3-2-5-11(12)8-9-14(15)24-17/h2-3,5-6,8-9,13H,4,7,10H2,1H3,(H,18,19,21) |
| InChIKey | IUSYEWRYSPSLOI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |