C7H3ClF2N2S — CID 174363206
4-chloro-5-(3,5-difluorothiophen-2-yl)-1H-pyrazole (PubChem CID 174363206) has the molecular formula C7H3ClF2N2S and a molecular weight of 220.63 g/mol. Its IUPAC name is 4-chloro-5-(3,5-difluorothiophen-2-yl)-1H-pyrazole.
| Compound Name | 4-chloro-5-(3,5-difluorothiophen-2-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 174363206 |
| Molecular Formula | C7H3ClF2N2S |
| Molecular Weight | 220.63 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | 4-chloro-5-(3,5-difluorothiophen-2-yl)-1H-pyrazole |
| SMILES | Fc1cc(F)c(-c2[nH]ncc2Cl)s1 |
| InChI | InChI=1S/C7H3ClF2N2S/c8-3-2-11-12-6(3)7-4(9)1-5(10)13-7/h1-2H,(H,11,12) |
| InChIKey | OMUIRPOFFHVMAT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |