C14H13Br2N3O2S — CID 174365963
1-(2,5-dibromophenyl)-1-(3-methylsulfonylphenyl)guanidine (PubChem CID 174365963) has the molecular formula C14H13Br2N3O2S and a molecular weight of 447.15 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-1-(3-methylsulfonylphenyl)guanidine.
| Compound Name | 1-(2,5-dibromophenyl)-1-(3-methylsulfonylphenyl)guanidine |
|---|---|
| PubChem CID | 174365963 |
| Molecular Formula | C14H13Br2N3O2S |
| Molecular Weight | 447.15 g/mol |
| Exact Mass | 444.91 |
| IUPAC Name | 1-(2,5-dibromophenyl)-1-(3-methylsulfonylphenyl)guanidine |
| SMILES | [H]/N=C(\N)N(c1cccc(S(C)(=O)=O)c1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H13Br2N3O2S/c1-22(20,21)11-4-2-3-10(8-11)19(14(17)18)13-7-9(15)5-6-12(13)16/h2-8H,1H3,(H3,17,18) |
| InChIKey | SCUZLLFEEYCBHB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.15 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|