C32H35N5O3 — CID 174367568
N'-(5-ethyl-6-methyl-2-phenoxy-3-pyridinyl)-4-(3-methoxyphenyl)-N'-phenylpiperazine-1-carbohydrazide (PubChem CID 174367568) has the molecular formula C32H35N5O3 and a molecular weight of 537.66 g/mol. Its IUPAC name is N'-(5-ethyl-6-methyl-2-phenoxy-3-pyridinyl)-4-(3-methoxyphenyl)-N'-phenylpiperazine-1-carbohydrazide.
| Compound Name | N'-(5-ethyl-6-methyl-2-phenoxy-3-pyridinyl)-4-(3-methoxyphenyl)-N'-phenylpiperazine-1-carbohydrazide |
|---|---|
| PubChem CID | 174367568 |
| Molecular Formula | C32H35N5O3 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | N'-(5-ethyl-6-methyl-2-phenoxy-3-pyridinyl)-4-(3-methoxyphenyl)-N'-phenylpiperazine-1-carbohydrazide |
| SMILES | CCc1cc(N(NC(=O)N2CCN(c3cccc(OC)c3)CC2)c2ccccc2)c(Oc2ccccc2)nc1C |
| InChI | InChI=1S/C32H35N5O3/c1-4-25-22-30(31(33-24(25)2)40-28-15-9-6-10-16-28)37(26-12-7-5-8-13-26)34-32(38)36-20-18-35(19-21-36)27-14-11-17-29(23-27)39-3/h5-17,22-23H,4,18-21H2,1-3H3,(H,34,38) |
| InChIKey | HNZBVVDHLJEYSV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|