C22H30N4O3S — CID 54396849
4-(3,5-dimethoxyphenyl)-N-(5-ethyl-2-methoxy-6-methyl-3-pyridinyl)piperazine-1-carbothioamide (PubChem CID 54396849) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenyl)-N-(5-ethyl-2-methoxy-6-methyl-3-pyridinyl)piperazine-1-carbothioamide.
| Compound Name | 4-(3,5-dimethoxyphenyl)-N-(5-ethyl-2-methoxy-6-methyl-3-pyridinyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 54396849 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 4-(3,5-dimethoxyphenyl)-N-(5-ethyl-2-methoxy-6-methyl-3-pyridinyl)piperazine-1-carbothioamide |
| SMILES | CCc1cc(NC(=S)N2CCN(c3cc(OC)cc(OC)c3)CC2)c(OC)nc1C |
| InChI | InChI=1S/C22H30N4O3S/c1-6-16-11-20(21(29-5)23-15(16)2)24-22(30)26-9-7-25(8-10-26)17-12-18(27-3)14-19(13-17)28-4/h11-14H,6-10H2,1-5H3,(H,24,30) |
| InChIKey | VKPBRFDWQACIMB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|