C23H31N3O4S — CID 54496252
4-(3,5-dimethoxyphenyl)-N-[5-(1-hydroxyethyl)-2-methoxy-4-methylphenyl]piperazine-1-carbothioamide (PubChem CID 54496252) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenyl)-N-[5-(1-hydroxyethyl)-2-methoxy-4-methylphenyl]piperazine-1-carbothioamide.
| Compound Name | 4-(3,5-dimethoxyphenyl)-N-[5-(1-hydroxyethyl)-2-methoxy-4-methylphenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 54496252 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 4-(3,5-dimethoxyphenyl)-N-[5-(1-hydroxyethyl)-2-methoxy-4-methylphenyl]piperazine-1-carbothioamide |
| SMILES | COc1cc(OC)cc(N2CCN(C(=S)Nc3cc(C(C)O)c(C)cc3OC)CC2)c1 |
| InChI | InChI=1S/C23H31N3O4S/c1-15-10-22(30-5)21(14-20(15)16(2)27)24-23(31)26-8-6-25(7-9-26)17-11-18(28-3)13-19(12-17)29-4/h10-14,16,27H,6-9H2,1-5H3,(H,24,31) |
| InChIKey | XZHZUUMTBXGQHS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|