C16H14ClN3O3S — CID 17436803
1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-3-propan-2-ylimidazolidine-2,4,5-trione (PubChem CID 17436803) has the molecular formula C16H14ClN3O3S and a molecular weight of 363.83 g/mol. Its IUPAC name is 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-3-propan-2-ylimidazolidine-2,4,5-trione.
| Compound Name | 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-3-propan-2-ylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 17436803 |
| Molecular Formula | C16H14ClN3O3S |
| Molecular Weight | 363.83 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 1-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-3-propan-2-ylimidazolidine-2,4,5-trione |
| SMILES | CC(C)N1C(=O)C(=O)N(Cc2csc(-c3ccccc3Cl)n2)C1=O |
| InChI | InChI=1S/C16H14ClN3O3S/c1-9(2)20-15(22)14(21)19(16(20)23)7-10-8-24-13(18-10)11-5-3-4-6-12(11)17/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | YZDUMRIMOKYCJN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.83 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|