C19H17Cl2N3O2 — CID 174368414
2-[4-[(4-acetylphenyl)methyl]-3,5-dichlorophenyl]-4,5-dihydro-3H-1,2,4-triazine-3-carbaldehyde (PubChem CID 174368414) has the molecular formula C19H17Cl2N3O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is 2-[4-[(4-acetylphenyl)methyl]-3,5-dichlorophenyl]-4,5-dihydro-3H-1,2,4-triazine-3-carbaldehyde.
| Compound Name | 2-[4-[(4-acetylphenyl)methyl]-3,5-dichlorophenyl]-4,5-dihydro-3H-1,2,4-triazine-3-carbaldehyde |
|---|---|
| PubChem CID | 174368414 |
| Molecular Formula | C19H17Cl2N3O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-[4-[(4-acetylphenyl)methyl]-3,5-dichlorophenyl]-4,5-dihydro-3H-1,2,4-triazine-3-carbaldehyde |
| SMILES | CC(=O)c1ccc(Cc2c(Cl)cc(N3N=CCNC3C=O)cc2Cl)cc1 |
| InChI | InChI=1S/C19H17Cl2N3O2/c1-12(26)14-4-2-13(3-5-14)8-16-17(20)9-15(10-18(16)21)24-19(11-25)22-6-7-23-24/h2-5,7,9-11,19,22H,6,8H2,1H3 |
| InChIKey | VZDBKGZLCLGNSV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|