About tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane
tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane (PubChem CID 174369675) has the molecular formula C16H27AlClNO2
and a molecular weight of 327.83 g/mol. Its IUPAC name is tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane.
Molecular Properties
| Compound Name | tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane |
| PubChem CID | 174369675 |
| Molecular Formula | C16H27AlClNO2 |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane |
| SMILES | CC[Al](Cl)CC.CN(C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C12H17NO2.2C2H5.Al.ClH/c1-12(2,3)15-11(14)13(4)10-8-6-5-7-9-10;2*1-2;;/h5-9H,1-4H3;2*1H2,2H3;;1H/q;;;+1;/p-1 |
| InChIKey | FWVPCKQKWZLVQI-UHFFFAOYSA-M |
| XLogP | 5.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane?
The IUPAC name of tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane (CID 174369675) is tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane.
What is the SMILES notation for tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane?
The canonical SMILES for tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane is CC[Al](Cl)CC.CN(C(=O)OC(C)(C)C)c1ccccc1.
What is the InChIKey of tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane?
The InChIKey is FWVPCKQKWZLVQI-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H17NO2.2C2H5.Al.ClH/c1-12(2,3)15-11(14)13(4)10-8-6-5-7-9-10;2*1-2;;/h5-9H,1-4H3;2*1H2,2H3;;1H/q;;;+1;/p-1.
What are the key properties of tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane?
tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane has a molecular weight of 327.83 g/mol, XLogP of 5.31, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-methyl-N-phenylcarbamate;chloro(diethyl)alumane is sourced from PubChem (CID 174369675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).