C13H14S — CID 174370194
2,5-dimethyl-3-[(Z)-prop-1-enyl]-1-benzothiophene (PubChem CID 174370194) has the molecular formula C13H14S and a molecular weight of 202.32 g/mol. Its IUPAC name is 2,5-dimethyl-3-[(Z)-prop-1-enyl]-1-benzothiophene.
| Compound Name | 2,5-dimethyl-3-[(Z)-prop-1-enyl]-1-benzothiophene |
|---|---|
| PubChem CID | 174370194 |
| Molecular Formula | C13H14S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 2,5-dimethyl-3-[(Z)-prop-1-enyl]-1-benzothiophene |
| SMILES | C/C=C\c1c(C)sc2ccc(C)cc12 |
| InChI | InChI=1S/C13H14S/c1-4-5-11-10(3)14-13-7-6-9(2)8-12(11)13/h4-8H,1-3H3/b5-4- |
| InChIKey | CVCDYOSLKXEHEG-PLNGDYQASA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |