About methoxycarbonyl 2-phenoxypropanoate
methoxycarbonyl 2-phenoxypropanoate (PubChem CID 174370299) has the molecular formula C11H12O5
and a molecular weight of 224.21 g/mol. Its IUPAC name is methoxycarbonyl 2-phenoxypropanoate.
Molecular Properties
| Compound Name | methoxycarbonyl 2-phenoxypropanoate |
| PubChem CID | 174370299 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | methoxycarbonyl 2-phenoxypropanoate |
| SMILES | COC(=O)OC(=O)C(C)Oc1ccccc1 |
| InChI | InChI=1S/C11H12O5/c1-8(10(12)16-11(13)14-2)15-9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | FPWRHIJFPKDLSV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methoxycarbonyl 2-phenoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxycarbonyl 2-phenoxypropanoate?
The IUPAC name of methoxycarbonyl 2-phenoxypropanoate (CID 174370299) is methoxycarbonyl 2-phenoxypropanoate.
What is the SMILES notation for methoxycarbonyl 2-phenoxypropanoate?
The canonical SMILES for methoxycarbonyl 2-phenoxypropanoate is COC(=O)OC(=O)C(C)Oc1ccccc1.
What is the InChIKey of methoxycarbonyl 2-phenoxypropanoate?
The InChIKey is FPWRHIJFPKDLSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O5/c1-8(10(12)16-11(13)14-2)15-9-6-4-3-5-7-9/h3-8H,1-2H3.
What are the key properties of methoxycarbonyl 2-phenoxypropanoate?
methoxycarbonyl 2-phenoxypropanoate has a molecular weight of 224.21 g/mol, XLogP of 1.76, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methoxycarbonyl 2-phenoxypropanoate is sourced from PubChem (CID 174370299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).