C13H16N6O2S2 — CID 17437207
1-[2-[1-(2-thiophen-2-ylethyl)tetrazol-5-yl]sulfanylpropanoyl]imidazolidin-2-one (PubChem CID 17437207) has the molecular formula C13H16N6O2S2 and a molecular weight of 352.45 g/mol. Its IUPAC name is 1-[2-[1-(2-thiophen-2-ylethyl)tetrazol-5-yl]sulfanylpropanoyl]imidazolidin-2-one.
| Compound Name | 1-[2-[1-(2-thiophen-2-ylethyl)tetrazol-5-yl]sulfanylpropanoyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 17437207 |
| Molecular Formula | C13H16N6O2S2 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 1-[2-[1-(2-thiophen-2-ylethyl)tetrazol-5-yl]sulfanylpropanoyl]imidazolidin-2-one |
| SMILES | CC(Sc1nnnn1CCc1cccs1)C(=O)N1CCNC1=O |
| InChI | InChI=1S/C13H16N6O2S2/c1-9(11(20)18-7-5-14-12(18)21)23-13-15-16-17-19(13)6-4-10-3-2-8-22-10/h2-3,8-9H,4-7H2,1H3,(H,14,21) |
| InChIKey | GUNYABYIECJHIQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |