C10H11FN4 — CID 174374268
[1-[(4-fluorophenyl)methyl]imidazol-2-yl]hydrazine (PubChem CID 174374268) has the molecular formula C10H11FN4 and a molecular weight of 206.22 g/mol. Its IUPAC name is [1-[(4-fluorophenyl)methyl]imidazol-2-yl]hydrazine.
| Compound Name | [1-[(4-fluorophenyl)methyl]imidazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 174374268 |
| Molecular Formula | C10H11FN4 |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | [1-[(4-fluorophenyl)methyl]imidazol-2-yl]hydrazine |
| SMILES | NNc1nccn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C10H11FN4/c11-9-3-1-8(2-4-9)7-15-6-5-13-10(15)14-12/h1-6H,7,12H2,(H,13,14) |
| InChIKey | DTJQAAXGPUEVBK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|