C16H24N6O2S — CID 17437880
2-[(4-cyclopropyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide (PubChem CID 17437880) has the molecular formula C16H24N6O2S and a molecular weight of 364.48 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide.
| Compound Name | 2-[(4-cyclopropyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 17437880 |
| Molecular Formula | C16H24N6O2S |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-[(4-cyclopropyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide |
| SMILES | C=CCNC(=O)NC(=O)CSc1nnc(N2CCCCC2)n1C1CC1 |
| InChI | InChI=1S/C16H24N6O2S/c1-2-8-17-14(24)18-13(23)11-25-16-20-19-15(22(16)12-6-7-12)21-9-4-3-5-10-21/h2,12H,1,3-11H2,(H2,17,18,23,24) |
| InChIKey | NMCNRMUABPVSIT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|