About azane;1-cyanopropan-2-yl cyclopropanecarboxylate
azane;1-cyanopropan-2-yl cyclopropanecarboxylate (PubChem CID 174380982) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is azane;1-cyanopropan-2-yl cyclopropanecarboxylate.
Molecular Properties
| Compound Name | azane;1-cyanopropan-2-yl cyclopropanecarboxylate |
| PubChem CID | 174380982 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | azane;1-cyanopropan-2-yl cyclopropanecarboxylate |
| SMILES | CC(CC#N)OC(=O)C1CC1.N |
| InChI | InChI=1S/C8H11NO2.H3N/c1-6(4-5-9)11-8(10)7-2-3-7;/h6-7H,2-4H2,1H3;1H3 |
| InChIKey | QZNOUWDSUDOWJQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;1-cyanopropan-2-yl cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-cyanopropan-2-yl cyclopropanecarboxylate?
The IUPAC name of azane;1-cyanopropan-2-yl cyclopropanecarboxylate (CID 174380982) is azane;1-cyanopropan-2-yl cyclopropanecarboxylate.
What is the SMILES notation for azane;1-cyanopropan-2-yl cyclopropanecarboxylate?
The canonical SMILES for azane;1-cyanopropan-2-yl cyclopropanecarboxylate is CC(CC#N)OC(=O)C1CC1.N.
What is the InChIKey of azane;1-cyanopropan-2-yl cyclopropanecarboxylate?
The InChIKey is QZNOUWDSUDOWJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2.H3N/c1-6(4-5-9)11-8(10)7-2-3-7;/h6-7H,2-4H2,1H3;1H3.
What are the key properties of azane;1-cyanopropan-2-yl cyclopropanecarboxylate?
azane;1-cyanopropan-2-yl cyclopropanecarboxylate has a molecular weight of 170.21 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-cyanopropan-2-yl cyclopropanecarboxylate is sourced from PubChem (CID 174380982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).