C10H17NO2S — CID 174382418
2-(oxepan-2-yloxymethyl)-4,5-dihydro-1,3-thiazole (PubChem CID 174382418) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 2-(oxepan-2-yloxymethyl)-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-(oxepan-2-yloxymethyl)-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 174382418 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 2-(oxepan-2-yloxymethyl)-4,5-dihydro-1,3-thiazole |
| SMILES | C1CCOC(OCC2=NCCS2)CC1 |
| InChI | InChI=1S/C10H17NO2S/c1-2-4-10(12-6-3-1)13-8-9-11-5-7-14-9/h10H,1-8H2 |
| InChIKey | SHBMXXYWJKGUBW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |