C10H26N5O+ — CID 174382567
[2-(2-aminoethylamino)ethylamino]-trimethylazanium;prop-2-enamide (PubChem CID 174382567) has the molecular formula C10H26N5O+ and a molecular weight of 232.35 g/mol. Its IUPAC name is [2-(2-aminoethylamino)ethylamino]-trimethylazanium;prop-2-enamide.
| Compound Name | [2-(2-aminoethylamino)ethylamino]-trimethylazanium;prop-2-enamide |
|---|---|
| PubChem CID | 174382567 |
| Molecular Formula | C10H26N5O+ |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.21 |
| IUPAC Name | [2-(2-aminoethylamino)ethylamino]-trimethylazanium;prop-2-enamide |
| SMILES | C=CC(N)=O.C[N+](C)(C)NCCNCCN |
| InChI | InChI=1S/C7H21N4.C3H5NO/c1-11(2,3)10-7-6-9-5-4-8;1-2-3(4)5/h9-10H,4-8H2,1-3H3;2H,1H2,(H2,4,5)/q+1; |
| InChIKey | PNJZHNBBFLUPGB-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|