C31H38N4O3 — CID 174383295
1-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]naphthalen-1-yl]urea (PubChem CID 174383295) has the molecular formula C31H38N4O3 and a molecular weight of 514.67 g/mol. Its IUPAC name is 1-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]naphthalen-1-yl]urea.
| Compound Name | 1-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 174383295 |
| Molecular Formula | C31H38N4O3 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 1-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]naphthalen-1-yl]urea |
| SMILES | O=C(Nc1ccc(-c2ccc(CN3CCOCC3)nc2)c2ccccc12)NC1CC2CCCCC2CC1O |
| InChI | InChI=1S/C31H38N4O3/c36-30-18-22-6-2-1-5-21(22)17-29(30)34-31(37)33-28-12-11-25(26-7-3-4-8-27(26)28)23-9-10-24(32-19-23)20-35-13-15-38-16-14-35/h3-4,7-12,19,21-22,29-30,36H,1-2,5-6,13-18,20H2,(H2,33,34,37) |
| InChIKey | ACAPKNDTZBNJRN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |