C20H16F3N3O2 — CID 174385427
3-amino-2-(pyridin-4-ylmethyl)-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 174385427) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is 3-amino-2-(pyridin-4-ylmethyl)-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 3-amino-2-(pyridin-4-ylmethyl)-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 174385427 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 3-amino-2-(pyridin-4-ylmethyl)-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | Nc1cccc(C(=O)Nc2ccc(OC(F)(F)F)cc2)c1Cc1ccncc1 |
| InChI | InChI=1S/C20H16F3N3O2/c21-20(22,23)28-15-6-4-14(5-7-15)26-19(27)16-2-1-3-18(24)17(16)12-13-8-10-25-11-9-13/h1-11H,12,24H2,(H,26,27) |
| InChIKey | MCYIVOCTRNUQNW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|