C9H13Cl6N — CID 174386912
1,4-bis(2,2,2-trichloroethyl)piperidine (PubChem CID 174386912) has the molecular formula C9H13Cl6N and a molecular weight of 347.93 g/mol. Its IUPAC name is 1,4-bis(2,2,2-trichloroethyl)piperidine.
| Compound Name | 1,4-bis(2,2,2-trichloroethyl)piperidine |
|---|---|
| PubChem CID | 174386912 |
| Molecular Formula | C9H13Cl6N |
| Molecular Weight | 347.93 g/mol |
| Exact Mass | 344.92 |
| IUPAC Name | 1,4-bis(2,2,2-trichloroethyl)piperidine |
| SMILES | ClC(Cl)(Cl)CC1CCN(CC(Cl)(Cl)Cl)CC1 |
| InChI | InChI=1S/C9H13Cl6N/c10-8(11,12)5-7-1-3-16(4-2-7)6-9(13,14)15/h7H,1-6H2 |
| InChIKey | XHTFUMLNXCQWLD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.93 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|