C7H13NO4S — CID 174389116
1-amino-2,4-dimethyl-3-oxopent-4-ene-2-sulfonic acid (PubChem CID 174389116) has the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. Its IUPAC name is 1-amino-2,4-dimethyl-3-oxopent-4-ene-2-sulfonic acid.
| Compound Name | 1-amino-2,4-dimethyl-3-oxopent-4-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 174389116 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 1-amino-2,4-dimethyl-3-oxopent-4-ene-2-sulfonic acid |
| SMILES | C=C(C)C(=O)C(C)(CN)S(=O)(=O)O |
| InChI | InChI=1S/C7H13NO4S/c1-5(2)6(9)7(3,4-8)13(10,11)12/h1,4,8H2,2-3H3,(H,10,11,12) |
| InChIKey | PYWCYLFNMOJNNF-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|