C8H14O3S — CID 115780896
2,4-dimethyl-4-methylsulfonylpent-1-en-3-one (PubChem CID 115780896) has the molecular formula C8H14O3S and a molecular weight of 190.26 g/mol. Its IUPAC name is 2,4-dimethyl-4-methylsulfonylpent-1-en-3-one.
| Compound Name | 2,4-dimethyl-4-methylsulfonylpent-1-en-3-one |
|---|---|
| PubChem CID | 115780896 |
| Molecular Formula | C8H14O3S |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2,4-dimethyl-4-methylsulfonylpent-1-en-3-one |
| SMILES | C=C(C)C(=O)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C8H14O3S/c1-6(2)7(9)8(3,4)12(5,10)11/h1H2,2-5H3 |
| InChIKey | WDQFJASFCKDGDH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|