C11H10N2O2 — CID 57094081
2,2-bis(2-methylprop-2-enoyl)propanedinitrile (PubChem CID 57094081) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2,2-bis(2-methylprop-2-enoyl)propanedinitrile.
| Compound Name | 2,2-bis(2-methylprop-2-enoyl)propanedinitrile |
|---|---|
| PubChem CID | 57094081 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2,2-bis(2-methylprop-2-enoyl)propanedinitrile |
| SMILES | C=C(C)C(=O)C(C#N)(C#N)C(=O)C(=C)C |
| InChI | InChI=1S/C11H10N2O2/c1-7(2)9(14)11(5-12,6-13)10(15)8(3)4/h1,3H2,2,4H3 |
| InChIKey | IYPUYMWIFAYSKL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|