C11H14O5 — CID 22461346
2,3-dihydroxy-5-methyl-2-(2-methylprop-2-enoyl)-4-oxohex-5-enal (PubChem CID 22461346) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2,3-dihydroxy-5-methyl-2-(2-methylprop-2-enoyl)-4-oxohex-5-enal.
| Compound Name | 2,3-dihydroxy-5-methyl-2-(2-methylprop-2-enoyl)-4-oxohex-5-enal |
|---|---|
| PubChem CID | 22461346 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2,3-dihydroxy-5-methyl-2-(2-methylprop-2-enoyl)-4-oxohex-5-enal |
| SMILES | C=C(C)C(=O)C(O)C(O)(C=O)C(=O)C(=C)C |
| InChI | InChI=1S/C11H14O5/c1-6(2)8(13)10(15)11(16,5-12)9(14)7(3)4/h5,10,15-16H,1,3H2,2,4H3 |
| InChIKey | GYAOIQUQWICZPL-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|