C15H21O6Ti — CID 21249519
hydroxy(oxo)titanium;4-hydroxy-2,4,7-trimethyl-5-(2-methylprop-2-enoyl)octa-1,7-diene-3,6-dione (PubChem CID 21249519) has the molecular formula C15H21O6Ti and a molecular weight of 345.19 g/mol. Its IUPAC name is hydroxy(oxo)titanium;4-hydroxy-2,4,7-trimethyl-5-(2-methylprop-2-enoyl)octa-1,7-diene-3,6-dione.
| Compound Name | hydroxy(oxo)titanium;4-hydroxy-2,4,7-trimethyl-5-(2-methylprop-2-enoyl)octa-1,7-diene-3,6-dione |
|---|---|
| PubChem CID | 21249519 |
| Molecular Formula | C15H21O6Ti |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | hydroxy(oxo)titanium;4-hydroxy-2,4,7-trimethyl-5-(2-methylprop-2-enoyl)octa-1,7-diene-3,6-dione |
| SMILES | C=C(C)C(=O)C(C(=O)C(=C)C)C(C)(O)C(=O)C(=C)C.O=[Ti]O |
| InChI | InChI=1S/C15H20O4.H2O.O.Ti/c1-8(2)12(16)11(13(17)9(3)4)15(7,19)14(18)10(5)6;;;/h11,19H,1,3,5H2,2,4,6-7H3;1H2;;/q;;;+1/p-1 |
| InChIKey | MBIVSQJNYRIRHB-UHFFFAOYSA-M |
| XLogP | 1.11 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|