C22H30O6S4 — CID 156761493
4-[hydroxy-[[1-hydroxy-2,4-dimethyl-2-(2-methylprop-2-enoyl)-3-oxopent-4-enyl]tetrasulfanyl]methyl]-2,4,6-trimethylhepta-1,6-diene-3,5-dione (PubChem CID 156761493) has the molecular formula C22H30O6S4 and a molecular weight of 518.74 g/mol. Its IUPAC name is 4-[hydroxy-[[1-hydroxy-2,4-dimethyl-2-(2-methylprop-2-enoyl)-3-oxopent-4-enyl]tetrasulfanyl]methyl]-2,4,6-trimethylhepta-1,6-diene-3,5-dione.
| Compound Name | 4-[hydroxy-[[1-hydroxy-2,4-dimethyl-2-(2-methylprop-2-enoyl)-3-oxopent-4-enyl]tetrasulfanyl]methyl]-2,4,6-trimethylhepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 156761493 |
| Molecular Formula | C22H30O6S4 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 4-[hydroxy-[[1-hydroxy-2,4-dimethyl-2-(2-methylprop-2-enoyl)-3-oxopent-4-enyl]tetrasulfanyl]methyl]-2,4,6-trimethylhepta-1,6-diene-3,5-dione |
| SMILES | C=C(C)C(=O)C(C)(C(=O)C(=C)C)C(O)SSSSC(O)C(C)(C(=O)C(=C)C)C(=O)C(=C)C |
| InChI | InChI=1S/C22H30O6S4/c1-11(2)15(23)21(9,16(24)12(3)4)19(27)29-31-32-30-20(28)22(10,17(25)13(5)6)18(26)14(7)8/h19-20,27-28H,1,3,5,7H2,2,4,6,8-10H3 |
| InChIKey | OSXNFGSHOLFPNS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|