C9H16O3S — CID 115780389
2,5-dimethyl-2-methylsulfonylhex-5-en-3-one (PubChem CID 115780389) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is 2,5-dimethyl-2-methylsulfonylhex-5-en-3-one.
| Compound Name | 2,5-dimethyl-2-methylsulfonylhex-5-en-3-one |
|---|---|
| PubChem CID | 115780389 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2,5-dimethyl-2-methylsulfonylhex-5-en-3-one |
| SMILES | C=C(C)CC(=O)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C9H16O3S/c1-7(2)6-8(10)9(3,4)13(5,11)12/h1,6H2,2-5H3 |
| InChIKey | ABHJEYMHWNGKLI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|