C11H23NO2S — CID 105039485
N,2,6-trimethyl-2-methylsulfonylhept-6-en-3-amine (PubChem CID 105039485) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is N,2,6-trimethyl-2-methylsulfonylhept-6-en-3-amine.
| Compound Name | N,2,6-trimethyl-2-methylsulfonylhept-6-en-3-amine |
|---|---|
| PubChem CID | 105039485 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N,2,6-trimethyl-2-methylsulfonylhept-6-en-3-amine |
| SMILES | C=C(C)CCC(NC)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H23NO2S/c1-9(2)7-8-10(12-5)11(3,4)15(6,13)14/h10,12H,1,7-8H2,2-6H3 |
| InChIKey | VGKMLTWVEYEGQZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|