C12H27NO2S — CID 105028788
N,2,7-trimethyl-2-methylsulfonyloctan-3-amine (PubChem CID 105028788) has the molecular formula C12H27NO2S and a molecular weight of 249.42 g/mol. Its IUPAC name is N,2,7-trimethyl-2-methylsulfonyloctan-3-amine.
| Compound Name | N,2,7-trimethyl-2-methylsulfonyloctan-3-amine |
|---|---|
| PubChem CID | 105028788 |
| Molecular Formula | C12H27NO2S |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N,2,7-trimethyl-2-methylsulfonyloctan-3-amine |
| SMILES | CNC(CCCC(C)C)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C12H27NO2S/c1-10(2)8-7-9-11(13-5)12(3,4)16(6,14)15/h10-11,13H,7-9H2,1-6H3 |
| InChIKey | DOWUWDXXNFYIFB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |