C14H31NO2S — CID 115845249
2,5-dimethyl-2-methylsulfonyl-N-propyloctan-3-amine (PubChem CID 115845249) has the molecular formula C14H31NO2S and a molecular weight of 277.47 g/mol. Its IUPAC name is 2,5-dimethyl-2-methylsulfonyl-N-propyloctan-3-amine.
| Compound Name | 2,5-dimethyl-2-methylsulfonyl-N-propyloctan-3-amine |
|---|---|
| PubChem CID | 115845249 |
| Molecular Formula | C14H31NO2S |
| Molecular Weight | 277.47 g/mol |
| Exact Mass | 277.21 |
| IUPAC Name | 2,5-dimethyl-2-methylsulfonyl-N-propyloctan-3-amine |
| SMILES | CCCNC(CC(C)CCC)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C14H31NO2S/c1-7-9-12(3)11-13(15-10-8-2)14(4,5)18(6,16)17/h12-13,15H,7-11H2,1-6H3 |
| InChIKey | VFYUUVGYTVGINR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |