C14H29N — CID 105039716
N,2,7,8,8-pentamethylnon-1-en-5-amine (PubChem CID 105039716) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is N,2,7,8,8-pentamethylnon-1-en-5-amine.
| Compound Name | N,2,7,8,8-pentamethylnon-1-en-5-amine |
|---|---|
| PubChem CID | 105039716 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | N,2,7,8,8-pentamethylnon-1-en-5-amine |
| SMILES | C=C(C)CCC(CC(C)C(C)(C)C)NC |
| InChI | InChI=1S/C14H29N/c1-11(2)8-9-13(15-7)10-12(3)14(4,5)6/h12-13,15H,1,8-10H2,2-7H3 |
| InChIKey | QOERJWMVHVCQMM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|