C27H31N3O7 — CID 174390176
tert-butyl N-methyl-N-[5-[8-[(2-methylpropan-2-yl)oxycarbonylamino]naphthalen-2-yl]oxy-2-nitrophenyl]carbamate (PubChem CID 174390176) has the molecular formula C27H31N3O7 and a molecular weight of 509.56 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[5-[8-[(2-methylpropan-2-yl)oxycarbonylamino]naphthalen-2-yl]oxy-2-nitrophenyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[5-[8-[(2-methylpropan-2-yl)oxycarbonylamino]naphthalen-2-yl]oxy-2-nitrophenyl]carbamate |
|---|---|
| PubChem CID | 174390176 |
| Molecular Formula | C27H31N3O7 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | tert-butyl N-methyl-N-[5-[8-[(2-methylpropan-2-yl)oxycarbonylamino]naphthalen-2-yl]oxy-2-nitrophenyl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1cc(Oc2ccc3cccc(NC(=O)OC(C)(C)C)c3c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H31N3O7/c1-26(2,3)36-24(31)28-21-10-8-9-17-11-12-18(15-20(17)21)35-19-13-14-22(30(33)34)23(16-19)29(7)25(32)37-27(4,5)6/h8-16H,1-7H3,(H,28,31) |
| InChIKey | VMFCTWJEQIEBAB-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|