C7H16N2O5S — CID 174390686
2,7-diamino-5-sulfoheptanoic acid (PubChem CID 174390686) has the molecular formula C7H16N2O5S and a molecular weight of 240.28 g/mol. Its IUPAC name is 2,7-diamino-5-sulfoheptanoic acid.
| Compound Name | 2,7-diamino-5-sulfoheptanoic acid |
|---|---|
| PubChem CID | 174390686 |
| Molecular Formula | C7H16N2O5S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2,7-diamino-5-sulfoheptanoic acid |
| SMILES | NCCC(CCC(N)C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C7H16N2O5S/c8-4-3-5(15(12,13)14)1-2-6(9)7(10)11/h5-6H,1-4,8-9H2,(H,10,11)(H,12,13,14) |
| InChIKey | VFQZTLKNQNQRMM-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|