C16H38N4O10S4 — CID 11592269
bis((2S)-2,6-diaminohexanoic acid);2-(2-sulfoethyldisulfanyl)ethanesulfonic acid (PubChem CID 11592269) has the molecular formula C16H38N4O10S4 and a molecular weight of 574.77 g/mol. Its IUPAC name is bis((2S)-2,6-diaminohexanoic acid);2-(2-sulfoethyldisulfanyl)ethanesulfonic acid.
| Compound Name | bis((2S)-2,6-diaminohexanoic acid);2-(2-sulfoethyldisulfanyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 11592269 |
| Molecular Formula | C16H38N4O10S4 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | bis((2S)-2,6-diaminohexanoic acid);2-(2-sulfoethyldisulfanyl)ethanesulfonic acid |
| SMILES | NCCCC[C@H](N)C(=O)O.NCCCC[C@H](N)C(=O)O.O=S(=O)(O)CCSSCCS(=O)(=O)O |
| InChI | InChI=1S/2C6H14N2O2.C4H10O6S4/c2*7-4-2-1-3-5(8)6(9)10;5-13(6,7)3-1-11-12-2-4-14(8,9)10/h2*5H,1-4,7-8H2,(H,9,10);1-4H2,(H,5,6,7)(H,8,9,10)/t2*5-;/m00./s1 |
| InChIKey | ZTSMMXZXMYYIHF-MDTVQASCSA-N |
| XLogP | -0.80 |
| TPSA | 287.42 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|