About tert-butyl formate;hexylcyclopropane
tert-butyl formate;hexylcyclopropane (PubChem CID 174391270) has the molecular formula C14H28O2
and a molecular weight of 228.38 g/mol. Its IUPAC name is tert-butyl formate;hexylcyclopropane.
Molecular Properties
| Compound Name | tert-butyl formate;hexylcyclopropane |
| PubChem CID | 174391270 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | tert-butyl formate;hexylcyclopropane |
| SMILES | CC(C)(C)OC=O.CCCCCCC1CC1 |
| InChI | InChI=1S/C9H18.C5H10O2/c1-2-3-4-5-6-9-7-8-9;1-5(2,3)7-4-6/h9H,2-8H2,1H3;4H,1-3H3 |
| InChIKey | CUKCLKBHDWEZML-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;hexylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;hexylcyclopropane?
The IUPAC name of tert-butyl formate;hexylcyclopropane (CID 174391270) is tert-butyl formate;hexylcyclopropane.
What is the SMILES notation for tert-butyl formate;hexylcyclopropane?
The canonical SMILES for tert-butyl formate;hexylcyclopropane is CC(C)(C)OC=O.CCCCCCC1CC1.
What is the InChIKey of tert-butyl formate;hexylcyclopropane?
The InChIKey is CUKCLKBHDWEZML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C5H10O2/c1-2-3-4-5-6-9-7-8-9;1-5(2,3)7-4-6/h9H,2-8H2,1H3;4H,1-3H3.
What are the key properties of tert-butyl formate;hexylcyclopropane?
tert-butyl formate;hexylcyclopropane has a molecular weight of 228.38 g/mol, XLogP of 4.32, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;hexylcyclopropane is sourced from PubChem (CID 174391270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).