C11H10NO3S- — CID 174392353
[methyl(naphthalen-2-yl)amino] sulfite (PubChem CID 174392353) has the molecular formula C11H10NO3S- and a molecular weight of 236.27 g/mol. Its IUPAC name is [methyl(naphthalen-2-yl)amino] sulfite.
| Compound Name | [methyl(naphthalen-2-yl)amino] sulfite |
|---|---|
| PubChem CID | 174392353 |
| Molecular Formula | C11H10NO3S- |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | [methyl(naphthalen-2-yl)amino] sulfite |
| SMILES | CN(OS(=O)[O-])c1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H11NO3S/c1-12(15-16(13)14)11-7-6-9-4-2-3-5-10(9)8-11/h2-8H,1H3,(H,13,14)/p-1 |
| InChIKey | OXLOGPGPQARCTE-UHFFFAOYSA-M |
| XLogP | 2.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|