C22H19N2O6S2- — CID 174905178
[[1-[3-(4-methoxyphenyl)sulfonylphenyl]indol-6-yl]-methylamino] sulfite (PubChem CID 174905178) has the molecular formula C22H19N2O6S2- and a molecular weight of 471.54 g/mol. Its IUPAC name is [[1-[3-(4-methoxyphenyl)sulfonylphenyl]indol-6-yl]-methylamino] sulfite.
| Compound Name | [[1-[3-(4-methoxyphenyl)sulfonylphenyl]indol-6-yl]-methylamino] sulfite |
|---|---|
| PubChem CID | 174905178 |
| Molecular Formula | C22H19N2O6S2- |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | [[1-[3-(4-methoxyphenyl)sulfonylphenyl]indol-6-yl]-methylamino] sulfite |
| SMILES | COc1ccc(S(=O)(=O)c2cccc(-n3ccc4ccc(N(C)OS(=O)[O-])cc43)c2)cc1 |
| InChI | InChI=1S/C22H20N2O6S2/c1-23(30-31(25)26)17-7-6-16-12-13-24(22(16)15-17)18-4-3-5-21(14-18)32(27,28)20-10-8-19(29-2)9-11-20/h3-15H,1-2H3,(H,25,26)/p-1 |
| InChIKey | VEXIBALSBLSACL-UHFFFAOYSA-M |
| XLogP | 3.63 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|