C29H25NO3 — CID 174980314
1,5,6-tris(4-methoxyphenyl)indole (PubChem CID 174980314) has the molecular formula C29H25NO3 and a molecular weight of 435.52 g/mol. Its IUPAC name is 1,5,6-tris(4-methoxyphenyl)indole.
| Compound Name | 1,5,6-tris(4-methoxyphenyl)indole |
|---|---|
| PubChem CID | 174980314 |
| Molecular Formula | C29H25NO3 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1,5,6-tris(4-methoxyphenyl)indole |
| SMILES | COc1ccc(-c2cc3ccn(-c4ccc(OC)cc4)c3cc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H25NO3/c1-31-24-10-4-20(5-11-24)27-18-22-16-17-30(23-8-14-26(33-3)15-9-23)29(22)19-28(27)21-6-12-25(32-2)13-7-21/h4-19H,1-3H3 |
| InChIKey | VYWNWCZRNDTCGY-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |