C20H21NO6 — CID 177165380
(2R,3R,4S,5S)-2-[4-(5-methoxyindol-1-yl)phenoxy]oxane-3,4,5-triol (PubChem CID 177165380) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[4-(5-methoxyindol-1-yl)phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S)-2-[4-(5-methoxyindol-1-yl)phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 177165380 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (2R,3R,4S,5S)-2-[4-(5-methoxyindol-1-yl)phenoxy]oxane-3,4,5-triol |
| SMILES | COc1ccc2c(ccn2-c2ccc(O[C@H]3OC[C@H](O)[C@H](O)[C@H]3O)cc2)c1 |
| InChI | InChI=1S/C20H21NO6/c1-25-15-6-7-16-12(10-15)8-9-21(16)13-2-4-14(5-3-13)27-20-19(24)18(23)17(22)11-26-20/h2-10,17-20,22-24H,11H2,1H3/t17-,18-,19+,20+/m0/s1 |
| InChIKey | UUUJPLVPQOQJOJ-VNTMZGSJSA-N |
| XLogP | 1.46 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |